C30H28F3N5O4S — CID 89288424
[5-[5-cyano-6-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-2-cyclopropyl-3-pyridinyl]quinolin-2-yl] trifluoromethanesulfonate (PubChem CID 89288424) has the molecular formula C30H28F3N5O4S and a molecular weight of 611.65 g/mol. Its IUPAC name is [5-[5-cyano-6-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-2-cyclopropyl-3-pyridinyl]quinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-[5-cyano-6-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-2-cyclopropyl-3-pyridinyl]quinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89288424 |
| Molecular Formula | C30H28F3N5O4S |
| Molecular Weight | 611.65 g/mol |
| Exact Mass | 611.18 |
| IUPAC Name | [5-[5-cyano-6-[4-(cyclopropanecarbonyl)-3-cyclopropylpiperazin-1-yl]-2-cyclopropyl-3-pyridinyl]quinolin-2-yl] trifluoromethanesulfonate |
| SMILES | N#Cc1cc(-c2cccc3nc(OS(=O)(=O)C(F)(F)F)ccc23)c(C2CC2)nc1N1CCN(C(=O)C2CC2)C(C2CC2)C1 |
| InChI | InChI=1S/C30H28F3N5O4S/c31-30(32,33)43(40,41)42-26-11-10-22-21(2-1-3-24(22)35-26)23-14-20(15-34)28(36-27(23)18-6-7-18)37-12-13-38(29(39)19-8-9-19)25(16-37)17-4-5-17/h1-3,10-11,14,17-19,25H,4-9,12-13,16H2 |
| InChIKey | PJEAVCUVMSIUDP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 116.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.65 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|