C21H17Cl2N3O4S — CID 123287107
2,6-dichloro-N-[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindazol-6-yl]benzamide (PubChem CID 123287107) has the molecular formula C21H17Cl2N3O4S and a molecular weight of 478.36 g/mol. Its IUPAC name is 2,6-dichloro-N-[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindazol-6-yl]benzamide.
| Compound Name | 2,6-dichloro-N-[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindazol-6-yl]benzamide |
|---|---|
| PubChem CID | 123287107 |
| Molecular Formula | C21H17Cl2N3O4S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.03 |
| IUPAC Name | 2,6-dichloro-N-[1-(3-methoxyphenyl)sulfonyl-2,3-dihydroindazol-6-yl]benzamide |
| SMILES | COc1cccc(S(=O)(=O)N2NCc3ccc(NC(=O)c4c(Cl)cccc4Cl)cc32)c1 |
| InChI | InChI=1S/C21H17Cl2N3O4S/c1-30-15-4-2-5-16(11-15)31(28,29)26-19-10-14(9-8-13(19)12-24-26)25-21(27)20-17(22)6-3-7-18(20)23/h2-11,24H,12H2,1H3,(H,25,27) |
| InChIKey | LYQIMBRVJVULST-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |