C21H16BrClFN3O3S — CID 90088404
N-[3-bromo-1-(3-methylphenyl)sulfonyl-2,3-dihydroindazol-6-yl]-2-chloro-6-fluorobenzamide (PubChem CID 90088404) has the molecular formula C21H16BrClFN3O3S and a molecular weight of 524.80 g/mol. Its IUPAC name is N-[3-bromo-1-(3-methylphenyl)sulfonyl-2,3-dihydroindazol-6-yl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[3-bromo-1-(3-methylphenyl)sulfonyl-2,3-dihydroindazol-6-yl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 90088404 |
| Molecular Formula | C21H16BrClFN3O3S |
| Molecular Weight | 524.80 g/mol |
| Exact Mass | 522.98 |
| IUPAC Name | N-[3-bromo-1-(3-methylphenyl)sulfonyl-2,3-dihydroindazol-6-yl]-2-chloro-6-fluorobenzamide |
| SMILES | Cc1cccc(S(=O)(=O)N2NC(Br)c3ccc(NC(=O)c4c(F)cccc4Cl)cc32)c1 |
| InChI | InChI=1S/C21H16BrClFN3O3S/c1-12-4-2-5-14(10-12)31(29,30)27-18-11-13(8-9-15(18)20(22)26-27)25-21(28)19-16(23)6-3-7-17(19)24/h2-11,20,26H,1H3,(H,25,28) |
| InChIKey | GKPZHELJUHRSLV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.80 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|