C22H19ClFN3O4S — CID 69282347
N-[(2S)-4-(3-aminophenyl)sulfonyl-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-6-fluorobenzamide (PubChem CID 69282347) has the molecular formula C22H19ClFN3O4S and a molecular weight of 475.93 g/mol. Its IUPAC name is N-[(2S)-4-(3-aminophenyl)sulfonyl-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[(2S)-4-(3-aminophenyl)sulfonyl-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 69282347 |
| Molecular Formula | C22H19ClFN3O4S |
| Molecular Weight | 475.93 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | N-[(2S)-4-(3-aminophenyl)sulfonyl-2-methyl-2,3-dihydro-1,4-benzoxazin-6-yl]-2-chloro-6-fluorobenzamide |
| SMILES | C[C@H]1CN(S(=O)(=O)c2cccc(N)c2)c2cc(NC(=O)c3c(F)cccc3Cl)ccc2O1 |
| InChI | InChI=1S/C22H19ClFN3O4S/c1-13-12-27(32(29,30)16-5-2-4-14(25)10-16)19-11-15(8-9-20(19)31-13)26-22(28)21-17(23)6-3-7-18(21)24/h2-11,13H,12,25H2,1H3,(H,26,28)/t13-/m0/s1 |
| InChIKey | VHJSGJGSVNAYAR-ZDUSSCGKSA-N |
| XLogP | 4.29 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|