C25H26FN5O2S — CID 123287594
4-[8-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]thiophene-2-carboxylic acid (PubChem CID 123287594) has the molecular formula C25H26FN5O2S and a molecular weight of 479.58 g/mol. Its IUPAC name is 4-[8-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]thiophene-2-carboxylic acid.
| Compound Name | 4-[8-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 123287594 |
| Molecular Formula | C25H26FN5O2S |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 4-[8-[3-fluoro-4-(4-propan-2-ylpiperazin-1-yl)anilino]imidazo[1,2-a]pyridin-5-yl]thiophene-2-carboxylic acid |
| SMILES | CC(C)N1CCN(c2ccc(Nc3ccc(-c4csc(C(=O)O)c4)n4ccnc34)cc2F)CC1 |
| InChI | InChI=1S/C25H26FN5O2S/c1-16(2)29-9-11-30(12-10-29)22-5-3-18(14-19(22)26)28-20-4-6-21(31-8-7-27-24(20)31)17-13-23(25(32)33)34-15-17/h3-8,13-16,28H,9-12H2,1-2H3,(H,32,33) |
| InChIKey | VGIKCJIBVBHEPB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|