C10H7FIN3O — CID 123287672
4-amino-6-(4-fluorophenyl)-5-iodo-1H-pyrimidin-2-one (PubChem CID 123287672) has the molecular formula C10H7FIN3O and a molecular weight of 331.09 g/mol. Its IUPAC name is 4-amino-6-(4-fluorophenyl)-5-iodo-1H-pyrimidin-2-one.
| Compound Name | 4-amino-6-(4-fluorophenyl)-5-iodo-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 123287672 |
| Molecular Formula | C10H7FIN3O |
| Molecular Weight | 331.09 g/mol |
| Exact Mass | 330.96 |
| IUPAC Name | 4-amino-6-(4-fluorophenyl)-5-iodo-1H-pyrimidin-2-one |
| SMILES | Nc1nc(=O)[nH]c(-c2ccc(F)cc2)c1I |
| InChI | InChI=1S/C10H7FIN3O/c11-6-3-1-5(2-4-6)8-7(12)9(13)15-10(16)14-8/h1-4H,(H3,13,14,15,16) |
| InChIKey | ZRZWTPSWHMDYIJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.09 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|