C11H8FN3O2S — CID 123970388
6-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide (PubChem CID 123970388) has the molecular formula C11H8FN3O2S and a molecular weight of 265.27 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 123970388 |
| Molecular Formula | C11H8FN3O2S |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 6-(4-fluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(F)cc2)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C11H8FN3O2S/c12-6-3-1-5(2-4-6)8-7(9(13)16)10(17)15-11(18)14-8/h1-4H,(H2,13,16)(H2,14,15,17,18) |
| InChIKey | AADVYELQEYWUGO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|