C14H15FN4S — CID 143513470
2-amino-5-[(Z)-1-aminobut-2-en-2-yl]-6-(4-fluorophenyl)-1H-pyrimidine-4-thione (PubChem CID 143513470) has the molecular formula C14H15FN4S and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-amino-5-[(Z)-1-aminobut-2-en-2-yl]-6-(4-fluorophenyl)-1H-pyrimidine-4-thione.
| Compound Name | 2-amino-5-[(Z)-1-aminobut-2-en-2-yl]-6-(4-fluorophenyl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 143513470 |
| Molecular Formula | C14H15FN4S |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 2-amino-5-[(Z)-1-aminobut-2-en-2-yl]-6-(4-fluorophenyl)-1H-pyrimidine-4-thione |
| SMILES | C/C=C(\CN)c1c(-c2ccc(F)cc2)[nH]c(N)nc1=S |
| InChI | InChI=1S/C14H15FN4S/c1-2-8(7-16)11-12(18-14(17)19-13(11)20)9-3-5-10(15)6-4-9/h2-6H,7,16H2,1H3,(H3,17,18,19,20)/b8-2+ |
| InChIKey | MJMGBLDPGWPRKR-KRXBUXKQSA-N |
| XLogP | 2.89 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|