C11H8N2O4S — CID 102109161
6-(2-hydroxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid (PubChem CID 102109161) has the molecular formula C11H8N2O4S and a molecular weight of 264.26 g/mol. Its IUPAC name is 6-(2-hydroxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-(2-hydroxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102109161 |
| Molecular Formula | C11H8N2O4S |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 6-(2-hydroxyphenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1c(-c2ccccc2O)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C11H8N2O4S/c14-6-4-2-1-3-5(6)8-7(10(16)17)9(15)13-11(18)12-8/h1-4,14H,(H,16,17)(H2,12,13,15,18) |
| InChIKey | QLNXFVHSWOTJPC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|