C10H8N2O3S — CID 117224711
5-(2-hydroxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid (PubChem CID 117224711) has the molecular formula C10H8N2O3S and a molecular weight of 236.25 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid.
| Compound Name | 5-(2-hydroxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117224711 |
| Molecular Formula | C10H8N2O3S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 5-(2-hydroxyphenyl)-2-sulfanylidene-1,3-dihydroimidazole-4-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(=S)[nH]c1-c1ccccc1O |
| InChI | InChI=1S/C10H8N2O3S/c13-6-4-2-1-3-5(6)7-8(9(14)15)12-10(16)11-7/h1-4,13H,(H,14,15)(H2,11,12,16) |
| InChIKey | FRMBKGBNCKMOGJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|