C8H6N2O2S — CID 116984038
3-sulfanylidene-2H-imidazo[1,5-a]pyridine-1-carboxylic acid (PubChem CID 116984038) has the molecular formula C8H6N2O2S and a molecular weight of 194.22 g/mol. Its IUPAC name is 3-sulfanylidene-2H-imidazo[1,5-a]pyridine-1-carboxylic acid.
| Compound Name | 3-sulfanylidene-2H-imidazo[1,5-a]pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 116984038 |
| Molecular Formula | C8H6N2O2S |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | 3-sulfanylidene-2H-imidazo[1,5-a]pyridine-1-carboxylic acid |
| SMILES | O=C(O)c1[nH]c(=S)n2ccccc12 |
| InChI | InChI=1S/C8H6N2O2S/c11-7(12)6-5-3-1-2-4-10(5)8(13)9-6/h1-4H,(H,9,13)(H,11,12) |
| InChIKey | HMVFYKJMMLUZIQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|