C12H12N6O3S — CID 145126709
N-(4-carbamohydrazonoylphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide (PubChem CID 145126709) has the molecular formula C12H12N6O3S and a molecular weight of 320.33 g/mol. Its IUPAC name is N-(4-carbamohydrazonoylphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-carbamohydrazonoylphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145126709 |
| Molecular Formula | C12H12N6O3S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | N-(4-carbamohydrazonoylphenyl)-6-hydroxy-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carboxamide |
| SMILES | NN=C(N)c1ccc(NC(=O)c2c(O)[nH]c(=S)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H12N6O3S/c13-8(18-14)5-1-3-6(4-2-5)15-9(19)7-10(20)16-12(22)17-11(7)21/h1-4H,14H2,(H2,13,18)(H,15,19)(H3,16,17,20,21,22) |
| InChIKey | MGYPMUXLHZOXBF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 162.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|