C12H13ClN2 — CID 123288377
3-(2-chlorophenyl)-4-ethyl-1-methylpyrazole (PubChem CID 123288377) has the molecular formula C12H13ClN2 and a molecular weight of 220.70 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-4-ethyl-1-methylpyrazole.
| Compound Name | 3-(2-chlorophenyl)-4-ethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 123288377 |
| Molecular Formula | C12H13ClN2 |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 3-(2-chlorophenyl)-4-ethyl-1-methylpyrazole |
| SMILES | CCc1cn(C)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C12H13ClN2/c1-3-9-8-15(2)14-12(9)10-6-4-5-7-11(10)13/h4-8H,3H2,1-2H3 |
| InChIKey | MHLUJYJYTXBDBM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |