About 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile
4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile (PubChem CID 123288938) has the molecular formula C19H24N2
and a molecular weight of 280.41 g/mol. Its IUPAC name is 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile |
| PubChem CID | 123288938 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNC23CC4CCC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C19H24N2/c20-12-14-1-3-15(4-2-14)13-21-19-9-16-5-6-17(10-19)8-18(7-16)11-19/h1-4,16-18,21H,5-11,13H2 |
| InChIKey | VCGAGYHQFKFXHQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile?
The IUPAC name of 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile (CID 123288938) is 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile.
What is the SMILES notation for 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile?
The canonical SMILES for 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile is N#Cc1ccc(CNC23CC4CCC(CC(C4)C2)C3)cc1.
What is the InChIKey of 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile?
The InChIKey is VCGAGYHQFKFXHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2/c20-12-14-1-3-15(4-2-14)13-21-19-9-16-5-6-17(10-19)8-18(7-16)11-19/h1-4,16-18,21H,5-11,13H2.
What are the key properties of 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile?
4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile has a molecular weight of 280.41 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1-tricyclo[4.3.1.13,8]undecanylamino)methyl]benzonitrile is sourced from PubChem (CID 123288938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).