C26H28N4 — CID 170205622
4-[[[3-[(4-cyanophenyl)methylamino]-1-adamantyl]amino]methyl]benzonitrile (PubChem CID 170205622) has the molecular formula C26H28N4 and a molecular weight of 396.54 g/mol. Its IUPAC name is 4-[[[3-[(4-cyanophenyl)methylamino]-1-adamantyl]amino]methyl]benzonitrile.
| Compound Name | 4-[[[3-[(4-cyanophenyl)methylamino]-1-adamantyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 170205622 |
| Molecular Formula | C26H28N4 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[[[3-[(4-cyanophenyl)methylamino]-1-adamantyl]amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNC23CC4CC(C2)CC(NCc2ccc(C#N)cc2)(C4)C3)cc1 |
| InChI | InChI=1S/C26H28N4/c27-14-19-1-5-21(6-2-19)16-29-25-10-23-9-24(11-25)13-26(12-23,18-25)30-17-22-7-3-20(15-28)4-8-22/h1-8,23-24,29-30H,9-13,16-18H2 |
| InChIKey | PYFBAGURXWJVOY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |