C18H28Cl2N2 — CID 163325426
3,5-dimethyl-N-(pyridin-4-ylmethyl)adamantan-1-amine;dihydrochloride (PubChem CID 163325426) has the molecular formula C18H28Cl2N2 and a molecular weight of 343.34 g/mol. Its IUPAC name is 3,5-dimethyl-N-(pyridin-4-ylmethyl)adamantan-1-amine;dihydrochloride.
| Compound Name | 3,5-dimethyl-N-(pyridin-4-ylmethyl)adamantan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 163325426 |
| Molecular Formula | C18H28Cl2N2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3,5-dimethyl-N-(pyridin-4-ylmethyl)adamantan-1-amine;dihydrochloride |
| SMILES | CC12CC3CC(C)(C1)CC(NCc1ccncc1)(C3)C2.Cl.Cl |
| InChI | InChI=1S/C18H26N2.2ClH/c1-16-7-15-8-17(2,11-16)13-18(9-15,12-16)20-10-14-3-5-19-6-4-14;;/h3-6,15,20H,7-13H2,1-2H3;2*1H |
| InChIKey | SMEBUWOVCOTLHS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |