C20H25N3O2 — CID 123289359
4-[3-[4-(2-methoxyethoxy)butyl]pyrrolo[2,3-c]pyridin-1-yl]aniline (PubChem CID 123289359) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 4-[3-[4-(2-methoxyethoxy)butyl]pyrrolo[2,3-c]pyridin-1-yl]aniline.
| Compound Name | 4-[3-[4-(2-methoxyethoxy)butyl]pyrrolo[2,3-c]pyridin-1-yl]aniline |
|---|---|
| PubChem CID | 123289359 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 4-[3-[4-(2-methoxyethoxy)butyl]pyrrolo[2,3-c]pyridin-1-yl]aniline |
| SMILES | COCCOCCCCc1cn(-c2ccc(N)cc2)c2cnccc12 |
| InChI | InChI=1S/C20H25N3O2/c1-24-12-13-25-11-3-2-4-16-15-23(18-7-5-17(21)6-8-18)20-14-22-10-9-19(16)20/h5-10,14-15H,2-4,11-13,21H2,1H3 |
| InChIKey | FJXQLZRMHGOKCB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|