C10H21N — CID 123289921
N,N,6-trimethylhept-2-en-3-amine (PubChem CID 123289921) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is N,N,6-trimethylhept-2-en-3-amine.
| Compound Name | N,N,6-trimethylhept-2-en-3-amine |
|---|---|
| PubChem CID | 123289921 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | N,N,6-trimethylhept-2-en-3-amine |
| SMILES | CC=C(CCC(C)C)N(C)C |
| InChI | InChI=1S/C10H21N/c1-6-10(11(4)5)8-7-9(2)3/h6,9H,7-8H2,1-5H3 |
| InChIKey | SWVKYGMENPYZEN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |