C14H22ClN — CID 123290817
6-butyl-5-chloro-3-ethyl-2,7-dimethyl-4H-azepine (PubChem CID 123290817) has the molecular formula C14H22ClN and a molecular weight of 239.79 g/mol. Its IUPAC name is 6-butyl-5-chloro-3-ethyl-2,7-dimethyl-4H-azepine.
| Compound Name | 6-butyl-5-chloro-3-ethyl-2,7-dimethyl-4H-azepine |
|---|---|
| PubChem CID | 123290817 |
| Molecular Formula | C14H22ClN |
| Molecular Weight | 239.79 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 6-butyl-5-chloro-3-ethyl-2,7-dimethyl-4H-azepine |
| SMILES | CCCCC1=C(Cl)CC(CC)=C(C)N=C1C |
| InChI | InChI=1S/C14H22ClN/c1-5-7-8-13-11(4)16-10(3)12(6-2)9-14(13)15/h5-9H2,1-4H3 |
| InChIKey | FYBUGTDVYMQTIG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.79 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |