C27H23ClN6O — CID 123291345
2-amino-6-[6-amino-5-(2-anilinoethyl)-3-pyridinyl]-3-(2-chlorophenyl)quinazolin-4-one (PubChem CID 123291345) has the molecular formula C27H23ClN6O and a molecular weight of 482.98 g/mol. Its IUPAC name is 2-amino-6-[6-amino-5-(2-anilinoethyl)-3-pyridinyl]-3-(2-chlorophenyl)quinazolin-4-one.
| Compound Name | 2-amino-6-[6-amino-5-(2-anilinoethyl)-3-pyridinyl]-3-(2-chlorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 123291345 |
| Molecular Formula | C27H23ClN6O |
| Molecular Weight | 482.98 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-amino-6-[6-amino-5-(2-anilinoethyl)-3-pyridinyl]-3-(2-chlorophenyl)quinazolin-4-one |
| SMILES | Nc1ncc(-c2ccc3nc(N)n(-c4ccccc4Cl)c(=O)c3c2)cc1CCNc1ccccc1 |
| InChI | InChI=1S/C27H23ClN6O/c28-22-8-4-5-9-24(22)34-26(35)21-15-17(10-11-23(21)33-27(34)30)19-14-18(25(29)32-16-19)12-13-31-20-6-2-1-3-7-20/h1-11,14-16,31H,12-13H2,(H2,29,32)(H2,30,33) |
| InChIKey | SZGKVZOHGWCYIQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.98 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |