C11H20O2 — CID 123292307
2-(2-ethylidene-5-methylhex-4-enoxy)ethanol (PubChem CID 123292307) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-(2-ethylidene-5-methylhex-4-enoxy)ethanol.
| Compound Name | 2-(2-ethylidene-5-methylhex-4-enoxy)ethanol |
|---|---|
| PubChem CID | 123292307 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2-(2-ethylidene-5-methylhex-4-enoxy)ethanol |
| SMILES | CC=C(CC=C(C)C)COCCO |
| InChI | InChI=1S/C11H20O2/c1-4-11(6-5-10(2)3)9-13-8-7-12/h4-5,12H,6-9H2,1-3H3 |
| InChIKey | IHZGUZZOKWGHFB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|