C31H31N2+ — CID 123292633
1-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-6,6-dimethyl-2,3-dihydropyrrolo[3,2-c]carbazol-6-ium (PubChem CID 123292633) has the molecular formula C31H31N2+ and a molecular weight of 431.60 g/mol. Its IUPAC name is 1-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-6,6-dimethyl-2,3-dihydropyrrolo[3,2-c]carbazol-6-ium.
| Compound Name | 1-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-6,6-dimethyl-2,3-dihydropyrrolo[3,2-c]carbazol-6-ium |
|---|---|
| PubChem CID | 123292633 |
| Molecular Formula | C31H31N2+ |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | 1-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-6,6-dimethyl-2,3-dihydropyrrolo[3,2-c]carbazol-6-ium |
| SMILES | CC1(C)c2cc(N3CCc4ccc5c(c43)-c3ccccc3[N+]5(C)C)ccc2C2C=CC=CC21 |
| InChI | InChI=1S/C31H31N2/c1-31(2)25-11-7-5-9-22(25)23-15-14-21(19-26(23)31)32-18-17-20-13-16-28-29(30(20)32)24-10-6-8-12-27(24)33(28,3)4/h5-16,19,22,25H,17-18H2,1-4H3/q+1 |
| InChIKey | HPLBYNQIZGGXCH-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|