C54H56N2 — CID 89111159
1-[9-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-10-(9,9-dimethyl-7,8-dihydrofluoren-3-yl)-6-piperidin-1-ylanthracen-2-yl]piperidine (PubChem CID 89111159) has the molecular formula C54H56N2 and a molecular weight of 733.06 g/mol. Its IUPAC name is 1-[9-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-10-(9,9-dimethyl-7,8-dihydrofluoren-3-yl)-6-piperidin-1-ylanthracen-2-yl]piperidine.
| Compound Name | 1-[9-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-10-(9,9-dimethyl-7,8-dihydrofluoren-3-yl)-6-piperidin-1-ylanthracen-2-yl]piperidine |
|---|---|
| PubChem CID | 89111159 |
| Molecular Formula | C54H56N2 |
| Molecular Weight | 733.06 g/mol |
| Exact Mass | 732.44 |
| IUPAC Name | 1-[9-(9,9-dimethyl-4b,8a-dihydrofluoren-2-yl)-10-(9,9-dimethyl-7,8-dihydrofluoren-3-yl)-6-piperidin-1-ylanthracen-2-yl]piperidine |
| SMILES | CC1(C)C2=C(C=CCC2)c2cc(-c3c4ccc(N5CCCCC5)cc4c(-c4ccc5c(c4)C(C)(C)C4C=CC=CC54)c4ccc(N5CCCCC5)cc34)ccc21 |
| InChI | InChI=1S/C54H56N2/c1-53(2)48-18-10-8-16-40(48)44-31-35(20-26-49(44)53)51-42-24-21-38(56-29-13-6-14-30-56)34-46(42)52(43-25-22-37(33-45(43)51)55-27-11-5-12-28-55)36-19-23-41-39-15-7-9-17-47(39)54(3,4)50(41)32-36/h7-9,15-17,19-26,31-34,39,47H,5-6,10-14,18,27-30H2,1-4H3 |
| InChIKey | APCYFZSPCBIMCG-UHFFFAOYSA-N |
| XLogP | 13.82 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.06 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|