C9H12F3NO — CID 123292821
(2E,5E)-3-methoxy-5-(trifluoromethyl)hepta-2,5-dien-4-imine (PubChem CID 123292821) has the molecular formula C9H12F3NO and a molecular weight of 207.19 g/mol. Its IUPAC name is (2E,5E)-3-methoxy-5-(trifluoromethyl)hepta-2,5-dien-4-imine.
| Compound Name | (2E,5E)-3-methoxy-5-(trifluoromethyl)hepta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123292821 |
| Molecular Formula | C9H12F3NO |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2E,5E)-3-methoxy-5-(trifluoromethyl)hepta-2,5-dien-4-imine |
| SMILES | [H]/N=C(C(=C/C)\OC)/C(=C\C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO/c1-4-6(9(10,11)12)8(13)7(5-2)14-3/h4-5,13H,1-3H3/b6-4+,7-5+,13-8- |
| InChIKey | GZPBCZCKWJEHKB-ZYWGCECKSA-N |
| XLogP | 3.06 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|