C7H11F3NO+ — CID 176670551
[(Z)-6,6,6-trifluoro-5-methoxyhex-4-en-3-ylidene]azanium (PubChem CID 176670551) has the molecular formula C7H11F3NO+ and a molecular weight of 182.16 g/mol. Its IUPAC name is [(Z)-6,6,6-trifluoro-5-methoxyhex-4-en-3-ylidene]azanium.
| Compound Name | [(Z)-6,6,6-trifluoro-5-methoxyhex-4-en-3-ylidene]azanium |
|---|---|
| PubChem CID | 176670551 |
| Molecular Formula | C7H11F3NO+ |
| Molecular Weight | 182.16 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | [(Z)-6,6,6-trifluoro-5-methoxyhex-4-en-3-ylidene]azanium |
| SMILES | CCC(=[NH2+])/C=C(\OC)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO/c1-3-5(11)4-6(12-2)7(8,9)10/h4,11H,3H2,1-2H3/p+1/b6-4-,11-5? |
| InChIKey | TXSNNGOVBKQKMK-RXNMKLAZSA-O |
| XLogP | 0.69 |
| TPSA | 34.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|