C28H39N3O5 — CID 123293199
tert-butyl 4-[[4-[4-(3-methoxyiminoazetidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate (PubChem CID 123293199) has the molecular formula C28H39N3O5 and a molecular weight of 497.64 g/mol. Its IUPAC name is tert-butyl 4-[[4-[4-(3-methoxyiminoazetidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[4-(3-methoxyiminoazetidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123293199 |
| Molecular Formula | C28H39N3O5 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | tert-butyl 4-[[4-[4-(3-methoxyiminoazetidine-1-carbonyl)cyclohexen-1-yl]phenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CON=C1CN(C(=O)C2CC=C(c3ccc(OCC4CCN(C(=O)OC(C)(C)C)CC4)cc3)CC2)C1 |
| InChI | InChI=1S/C28H39N3O5/c1-28(2,3)36-27(33)30-15-13-20(14-16-30)19-35-25-11-9-22(10-12-25)21-5-7-23(8-6-21)26(32)31-17-24(18-31)29-34-4/h5,9-12,20,23H,6-8,13-19H2,1-4H3 |
| InChIKey | IBUBQQIMXXHENQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 80.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|