About Etilamfetamine, (R)-
Etilamfetamine, (R)- (PubChem CID 12329382) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is (2R)-N-ethyl-1-phenylpropan-2-amine.
Molecular Properties
| Compound Name | Etilamfetamine, (R)- |
| PubChem CID | 12329382 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2R)-N-ethyl-1-phenylpropan-2-amine |
| SMILES | CCN[C@H](C)CC1=CC=CC=C1 |
| InChI | InChI=1S/C11H17N/c1-3-12-10(2)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | YAGBSNMZQKEFCO-SNVBAGLBSA-N |
| XLogP | 2.50 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 106 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Etilamfetamine, (R)- with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Etilamfetamine, (R)-?
The IUPAC name of Etilamfetamine, (R)- (CID 12329382) is (2R)-N-ethyl-1-phenylpropan-2-amine.
What is the SMILES notation for Etilamfetamine, (R)-?
The canonical SMILES for Etilamfetamine, (R)- is CCN[C@H](C)CC1=CC=CC=C1.
What is the InChIKey of Etilamfetamine, (R)-?
The InChIKey is YAGBSNMZQKEFCO-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H17N/c1-3-12-10(2)9-11-7-5-4-6-8-11/h4-8,10,12H,3,9H2,1-2H3/t10-/m1/s1.
What are the key properties of Etilamfetamine, (R)-?
Etilamfetamine, (R)- has a molecular weight of 163.26 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Etilamfetamine, (R)- is sourced from PubChem (CID 12329382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).