C13H20N2 — CID 123294210
4-(2,5-dimethylhexa-2,4-dien-3-yl)-5-methyl-1,4-dihydropyrimidine (PubChem CID 123294210) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 4-(2,5-dimethylhexa-2,4-dien-3-yl)-5-methyl-1,4-dihydropyrimidine.
| Compound Name | 4-(2,5-dimethylhexa-2,4-dien-3-yl)-5-methyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 123294210 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 4-(2,5-dimethylhexa-2,4-dien-3-yl)-5-methyl-1,4-dihydropyrimidine |
| SMILES | CC(C)=CC(=C(C)C)C1N=CNC=C1C |
| InChI | InChI=1S/C13H20N2/c1-9(2)6-12(10(3)4)13-11(5)7-14-8-15-13/h6-8,13H,1-5H3,(H,14,15) |
| InChIKey | BUCAQQGGEYEFHQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|