C10H14N2 — CID 129060116
N-(2-ethenylcyclohexa-1,5-dien-1-yl)-N'-methylmethanimidamide (PubChem CID 129060116) has the molecular formula C10H14N2 and a molecular weight of 162.23 g/mol. Its IUPAC name is N-(2-ethenylcyclohexa-1,5-dien-1-yl)-N'-methylmethanimidamide.
| Compound Name | N-(2-ethenylcyclohexa-1,5-dien-1-yl)-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 129060116 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | N-(2-ethenylcyclohexa-1,5-dien-1-yl)-N'-methylmethanimidamide |
| SMILES | CN=CNC1=C(CCC=C1)C=C |
| InChI | InChI=1S/C10H14N2/c1-3-9-6-4-5-7-10(9)12-8-11-2/h3,5,7-8H,1,4,6H2,2H3,(H,11,12) |
| InChIKey | SQVXANXZJNCGOQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 24.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | 247 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|