C13H19N3 — CID 123296551
1-methyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]piperidine-4-carbonitrile (PubChem CID 123296551) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-methyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]piperidine-4-carbonitrile.
| Compound Name | 1-methyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 123296551 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-methyl-4-[1-(methylideneamino)penta-1,3-dien-2-yl]piperidine-4-carbonitrile |
| SMILES | C=NC=C(C=CC)C1(C#N)CCN(C)CC1 |
| InChI | InChI=1S/C13H19N3/c1-4-5-12(10-15-2)13(11-14)6-8-16(3)9-7-13/h4-5,10H,2,6-9H2,1,3H3 |
| InChIKey | QLUYRGXHSXDJTC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|