C15H23N3 — CID 123804150
4-[5-(aziridin-1-yl)penta-2,4-dienyl]-1-ethylpiperidine-4-carbonitrile (PubChem CID 123804150) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 4-[5-(aziridin-1-yl)penta-2,4-dienyl]-1-ethylpiperidine-4-carbonitrile.
| Compound Name | 4-[5-(aziridin-1-yl)penta-2,4-dienyl]-1-ethylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 123804150 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 4-[5-(aziridin-1-yl)penta-2,4-dienyl]-1-ethylpiperidine-4-carbonitrile |
| SMILES | CCN1CCC(C#N)(CC=CC=CN2CC2)CC1 |
| InChI | InChI=1S/C15H23N3/c1-2-17-10-7-15(14-16,8-11-17)6-4-3-5-9-18-12-13-18/h3-5,9H,2,6-8,10-13H2,1H3 |
| InChIKey | UMIPMTSKONSYPF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 30.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|