C16H32O2 — CID 123297352
tert-butyl 2-ethyl-4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 123297352) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is tert-butyl 2-ethyl-4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | tert-butyl 2-ethyl-4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123297352 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | tert-butyl 2-ethyl-4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CCC(CC(C)(C)C)(C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H32O2/c1-10-16(12(2)3,11-14(4,5)6)13(17)18-15(7,8)9/h12H,10-11H2,1-9H3 |
| InChIKey | LIRCSSCBGSXPNC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |