C7H11N — CID 123297496
N-(3-methylbuta-1,3-dienyl)ethanimine (PubChem CID 123297496) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is N-(3-methylbuta-1,3-dienyl)ethanimine.
| Compound Name | N-(3-methylbuta-1,3-dienyl)ethanimine |
|---|---|
| PubChem CID | 123297496 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N-(3-methylbuta-1,3-dienyl)ethanimine |
| SMILES | C=C(C)C=C/N=C/C |
| InChI | InChI=1S/C7H11N/c1-4-8-6-5-7(2)3/h4-6H,2H2,1,3H3/b6-5?,8-4+ |
| InChIKey | NBHOIYJOOLKJCG-KEFBPMMISA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|