C7H10FN — CID 144826258
N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]ethanimine (PubChem CID 144826258) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 144826258 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N-[(1E)-2-fluoro-3-methylbuta-1,3-dienyl]ethanimine |
| SMILES | C=C(C)/C(F)=C\N=C\C |
| InChI | InChI=1S/C7H10FN/c1-4-9-5-7(8)6(2)3/h4-5H,2H2,1,3H3/b7-5+,9-4+ |
| InChIKey | APTIFAQAVIEXFV-PGWPIGLESA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|