C6H8FN — CID 90764020
4-fluoro-5-methyl-3,4-dihydropyridine (PubChem CID 90764020) has the molecular formula C6H8FN and a molecular weight of 113.13 g/mol. Its IUPAC name is 4-fluoro-5-methyl-3,4-dihydropyridine.
| Compound Name | 4-fluoro-5-methyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 90764020 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | 4-fluoro-5-methyl-3,4-dihydropyridine |
| SMILES | CC1=CN=CCC1F |
| InChI | InChI=1S/C6H8FN/c1-5-4-8-3-2-6(5)7/h3-4,6H,2H2,1H3 |
| InChIKey | KWNCHTSVOZILGS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |