C7H10FN — CID 123285144
N-(1-fluoro-2,3-dimethylbuta-1,3-dienyl)methanimine (PubChem CID 123285144) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-(1-fluoro-2,3-dimethylbuta-1,3-dienyl)methanimine.
| Compound Name | N-(1-fluoro-2,3-dimethylbuta-1,3-dienyl)methanimine |
|---|---|
| PubChem CID | 123285144 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N-(1-fluoro-2,3-dimethylbuta-1,3-dienyl)methanimine |
| SMILES | C=NC(F)=C(C)C(=C)C |
| InChI | InChI=1S/C7H10FN/c1-5(2)6(3)7(8)9-4/h1,4H2,2-3H3 |
| InChIKey | XFBMBLRYMRDHNZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|