C7H9F2N — CID 143620754
(1E)-N-[(1E,3Z)-1-fluoro-3-methylpenta-1,3-dienyl]methanimidoyl fluoride (PubChem CID 143620754) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is (1E)-N-[(1E,3Z)-1-fluoro-3-methylpenta-1,3-dienyl]methanimidoyl fluoride.
| Compound Name | (1E)-N-[(1E,3Z)-1-fluoro-3-methylpenta-1,3-dienyl]methanimidoyl fluoride |
|---|---|
| PubChem CID | 143620754 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (1E)-N-[(1E,3Z)-1-fluoro-3-methylpenta-1,3-dienyl]methanimidoyl fluoride |
| SMILES | C/C=C(C)\C=C(F)/N=C/F |
| InChI | InChI=1S/C7H9F2N/c1-3-6(2)4-7(9)10-5-8/h3-5H,1-2H3/b6-3-,7-4-,10-5+ |
| InChIKey | PUOKYGMGNHZBKH-PELDVPSQSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|