C8H10FN — CID 143398737
N-[(1Z,3Z)-3-methylhexa-1,3,5-trienyl]methanimidoyl fluoride (PubChem CID 143398737) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is N-[(1Z,3Z)-3-methylhexa-1,3,5-trienyl]methanimidoyl fluoride.
| Compound Name | N-[(1Z,3Z)-3-methylhexa-1,3,5-trienyl]methanimidoyl fluoride |
|---|---|
| PubChem CID | 143398737 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | N-[(1Z,3Z)-3-methylhexa-1,3,5-trienyl]methanimidoyl fluoride |
| SMILES | C=C/C=C(C)\C=C/N=C/F |
| InChI | InChI=1S/C8H10FN/c1-3-4-8(2)5-6-10-7-9/h3-7H,1H2,2H3/b6-5-,8-4-,10-7+ |
| InChIKey | OVGGKGGBGBOARK-VXLXXJATSA-N |
| XLogP | 2.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|