C7H10FN — CID 130296619
N-[(1Z,3E)-4-fluoro-2-methylpenta-1,3-dienyl]methanimine (PubChem CID 130296619) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-[(1Z,3E)-4-fluoro-2-methylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-4-fluoro-2-methylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 130296619 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | N-[(1Z,3E)-4-fluoro-2-methylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(C)\C=C(/C)F |
| InChI | InChI=1S/C7H10FN/c1-6(5-9-3)4-7(2)8/h4-5H,3H2,1-2H3/b6-5-,7-4+ |
| InChIKey | HEJWLHNBGULKJI-IUQJDUBZSA-N |
| XLogP | 2.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|