N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride

C7H10FN — CID 139386678

IUPACN-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride
SMILESC/C=C\C(C)=C/N=C/F
InChIInChI=1S/C7H10FN/c1-3-4-7(2)5-9-6-8/h3-6H,1-2H3/b4-3-,7-5-,9-6+
InChIKeyFPSMZLIBFBQDIF-CGFWPMDESA-N
MW127.16 g/mol
LogP2.46
Rot. Bonds2

About N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride

N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride (PubChem CID 139386678) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride.

Molecular Properties

Compound NameN-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride
PubChem CID139386678
Molecular FormulaC7H10FN
Molecular Weight127.16 g/mol
Exact Mass127.08
IUPAC NameN-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride
SMILESC/C=C\C(C)=C/N=C/F
InChIInChI=1S/C7H10FN/c1-3-4-7(2)5-9-6-8/h3-6H,1-2H3/b4-3-,7-5-,9-6+
InChIKeyFPSMZLIBFBQDIF-CGFWPMDESA-N
XLogP2.46
TPSA12.36 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.16
LogP ≤ 52.46
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride?
The IUPAC name of N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride (CID 139386678) is N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride.
What is the SMILES notation for N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride?
The canonical SMILES for N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride is C/C=C\C(C)=C/N=C/F.
What is the InChIKey of N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride?
The InChIKey is FPSMZLIBFBQDIF-CGFWPMDESA-N. The full InChI is InChI=1S/C7H10FN/c1-3-4-7(2)5-9-6-8/h3-6H,1-2H3/b4-3-,7-5-,9-6+.
What are the key properties of N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride?
N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride has a molecular weight of 127.16 g/mol, XLogP of 2.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z,3Z)-2-methylpenta-1,3-dienyl]methanimidoyl fluoride is sourced from PubChem (CID 139386678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).