C16H28O — CID 123299528
5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-ol (PubChem CID 123299528) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123299528 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 5-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)(C)CC(C1=CC=CC(O)C1)C(C)(C)C |
| InChI | InChI=1S/C16H28O/c1-15(2,3)11-14(16(4,5)6)12-8-7-9-13(17)10-12/h7-9,13-14,17H,10-11H2,1-6H3 |
| InChIKey | ARHMELJOCBVRMC-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |