C9H17NOS — CID 123300412
4-(3-methylcyclobutyl)-1,4-thiazinane 1-oxide (PubChem CID 123300412) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 4-(3-methylcyclobutyl)-1,4-thiazinane 1-oxide.
| Compound Name | 4-(3-methylcyclobutyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 123300412 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 4-(3-methylcyclobutyl)-1,4-thiazinane 1-oxide |
| SMILES | CC1CC(N2CCS(=O)CC2)C1 |
| InChI | InChI=1S/C9H17NOS/c1-8-6-9(7-8)10-2-4-12(11)5-3-10/h8-9H,2-7H2,1H3 |
| InChIKey | RWWCQBXZOMHXJW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |