C15H21N — CID 123300820
3-(1-cyclohex-2-en-1-yl-1-isocyanoethyl)cyclohexene (PubChem CID 123300820) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-(1-cyclohex-2-en-1-yl-1-isocyanoethyl)cyclohexene.
| Compound Name | 3-(1-cyclohex-2-en-1-yl-1-isocyanoethyl)cyclohexene |
|---|---|
| PubChem CID | 123300820 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-(1-cyclohex-2-en-1-yl-1-isocyanoethyl)cyclohexene |
| SMILES | [C-]#[N+]C(C)(C1C=CCCC1)C1C=CCCC1 |
| InChI | InChI=1S/C15H21N/c1-15(16-2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h5,7,9,11,13-14H,3-4,6,8,10,12H2,1H3 |
| InChIKey | PRUWQPRRMXGUJK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|