C14H21N — CID 58555286
(1S,5R)-2-(2-isocyano-2-methylpropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 58555286) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (1S,5R)-2-(2-isocyano-2-methylpropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
| Compound Name | (1S,5R)-2-(2-isocyano-2-methylpropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
|---|---|
| PubChem CID | 58555286 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (1S,5R)-2-(2-isocyano-2-methylpropyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | [C-]#[N+]C(C)(C)CC1=CC[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C14H21N/c1-13(2,15-5)9-10-6-7-11-8-12(10)14(11,3)4/h6,11-12H,7-9H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | XEBWUBUOJKIKNQ-VXGBXAGGSA-N |
| XLogP | 4.07 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|