C24H37N5O3 — CID 123300993
1-[3-oxo-3-[3-[2-(2-piperidin-1-ylethylamino)acetyl]anilino]propyl]piperidine-4-carboxamide (PubChem CID 123300993) has the molecular formula C24H37N5O3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-[3-oxo-3-[3-[2-(2-piperidin-1-ylethylamino)acetyl]anilino]propyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-oxo-3-[3-[2-(2-piperidin-1-ylethylamino)acetyl]anilino]propyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 123300993 |
| Molecular Formula | C24H37N5O3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.29 |
| IUPAC Name | 1-[3-oxo-3-[3-[2-(2-piperidin-1-ylethylamino)acetyl]anilino]propyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(CCC(=O)Nc2cccc(C(=O)CNCCN3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C24H37N5O3/c25-24(32)19-7-13-29(14-8-19)15-9-23(31)27-21-6-4-5-20(17-21)22(30)18-26-10-16-28-11-2-1-3-12-28/h4-6,17,19,26H,1-3,7-16,18H2,(H2,25,32)(H,27,31) |
| InChIKey | HRHLTSZIEZBSOH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|