About N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide
N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide (PubChem CID 123301072) has the molecular formula C10H22N2S
and a molecular weight of 202.37 g/mol. Its IUPAC name is N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide.
Molecular Properties
| Compound Name | N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide |
| PubChem CID | 123301072 |
| Molecular Formula | C10H22N2S |
| Molecular Weight | 202.37 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide |
| SMILES | CCSN=C(C)N(C(C)C)C(C)C |
| InChI | InChI=1S/C10H22N2S/c1-7-13-11-10(6)12(8(2)3)9(4)5/h8-9H,7H2,1-6H3 |
| InChIKey | DOSQGGWWTAFQGW-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide?
The IUPAC name of N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide (CID 123301072) is N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide.
What is the SMILES notation for N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide?
The canonical SMILES for N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide is CCSN=C(C)N(C(C)C)C(C)C.
What is the InChIKey of N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide?
The InChIKey is DOSQGGWWTAFQGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2S/c1-7-13-11-10(6)12(8(2)3)9(4)5/h8-9H,7H2,1-6H3.
What are the key properties of N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide?
N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide has a molecular weight of 202.37 g/mol, XLogP of 3.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethylsulfanyl-N,N-di(propan-2-yl)ethanimidamide is sourced from PubChem (CID 123301072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).