C12H30N2S — CID 156751234
N,N-diethyl-N'-methylethanimidamide;ethane;propane-1-thiol (PubChem CID 156751234) has the molecular formula C12H30N2S and a molecular weight of 234.45 g/mol. Its IUPAC name is N,N-diethyl-N'-methylethanimidamide;ethane;propane-1-thiol.
| Compound Name | N,N-diethyl-N'-methylethanimidamide;ethane;propane-1-thiol |
|---|---|
| PubChem CID | 156751234 |
| Molecular Formula | C12H30N2S |
| Molecular Weight | 234.45 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | N,N-diethyl-N'-methylethanimidamide;ethane;propane-1-thiol |
| SMILES | CC.CCCS.CCN(CC)/C(C)=N/C |
| InChI | InChI=1S/C7H16N2.C3H8S.C2H6/c1-5-9(6-2)7(3)8-4;1-2-3-4;1-2/h5-6H2,1-4H3;4H,2-3H2,1H3;1-2H3/b8-7+;; |
| InChIKey | MUEKVPKBQZDZFO-MIIBGCIDSA-N |
| XLogP | 3.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|