C9H22N2S — CID 156861475
N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide;ethane (PubChem CID 156861475) has the molecular formula C9H22N2S and a molecular weight of 190.36 g/mol. Its IUPAC name is N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide;ethane.
| Compound Name | N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide;ethane |
|---|---|
| PubChem CID | 156861475 |
| Molecular Formula | C9H22N2S |
| Molecular Weight | 190.36 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide;ethane |
| SMILES | C/N=C(\C)N(C)CCCS.CC |
| InChI | InChI=1S/C7H16N2S.C2H6/c1-7(8-2)9(3)5-4-6-10;1-2/h10H,4-6H2,1-3H3;1-2H3/b8-7+; |
| InChIKey | JGJJNUSGEKYVSZ-USRGLUTNSA-N |
| XLogP | 2.31 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|