C7H16N2S — CID 156861476
N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide (PubChem CID 156861476) has the molecular formula C7H16N2S and a molecular weight of 160.29 g/mol. Its IUPAC name is N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide.
| Compound Name | N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide |
|---|---|
| PubChem CID | 156861476 |
| Molecular Formula | C7H16N2S |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | N,N'-dimethyl-N-(3-sulfanylpropyl)ethanimidamide |
| SMILES | C/N=C(\C)N(C)CCCS |
| InChI | InChI=1S/C7H16N2S/c1-7(8-2)9(3)5-4-6-10/h10H,4-6H2,1-3H3/b8-7+ |
| InChIKey | PXXJUSUWYSBGFK-BQYQJAHWSA-N |
| XLogP | 1.29 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|