C6H12N2S — CID 163429469
(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanethiol (PubChem CID 163429469) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is (1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanethiol.
| Compound Name | (1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanethiol |
|---|---|
| PubChem CID | 163429469 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | (1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)methanethiol |
| SMILES | CN1CCCN=C1CS |
| InChI | InChI=1S/C6H12N2S/c1-8-4-2-3-7-6(8)5-9/h9H,2-5H2,1H3 |
| InChIKey | APFZTIOCFXTPBH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|